C19H32O6 — CID 153277957
tert-butyl 2-[(2E)-6-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyloxy]cyclooct-2-en-1-yl]acetate (PubChem CID 153277957) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is tert-butyl 2-[(2E)-6-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyloxy]cyclooct-2-en-1-yl]acetate.
| Compound Name | tert-butyl 2-[(2E)-6-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyloxy]cyclooct-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 153277957 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | tert-butyl 2-[(2E)-6-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyloxy]cyclooct-2-en-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1/C=C\C(OC(=O)OC(C)(C)C)CC(O)CC1 |
| InChI | InChI=1S/C19H32O6/c1-18(2,3)24-16(21)11-13-7-9-14(20)12-15(10-8-13)23-17(22)25-19(4,5)6/h8,10,13-15,20H,7,9,11-12H2,1-6H3/b10-8- |
| InChIKey | GRVWCDMBCXXUJI-NTMALXAHSA-N |
| XLogP | 3.76 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|