C13H20O3 — CID 150057863
tert-butyl 2-[(1S)-4-methyl-5-oxocyclohex-2-en-1-yl]acetate (PubChem CID 150057863) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is tert-butyl 2-[(1S)-4-methyl-5-oxocyclohex-2-en-1-yl]acetate.
| Compound Name | tert-butyl 2-[(1S)-4-methyl-5-oxocyclohex-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 150057863 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | tert-butyl 2-[(1S)-4-methyl-5-oxocyclohex-2-en-1-yl]acetate |
| SMILES | CC1C=C[C@H](CC(=O)OC(C)(C)C)CC1=O |
| InChI | InChI=1S/C13H20O3/c1-9-5-6-10(7-11(9)14)8-12(15)16-13(2,3)4/h5-6,9-10H,7-8H2,1-4H3/t9?,10-/m0/s1 |
| InChIKey | DMRIVXVEWCOEPE-AXDSSHIGSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|