C13H18O3 — CID 100933893
tert-butyl 2-(4-formylcyclohexa-2,4-dien-1-yl)acetate (PubChem CID 100933893) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is tert-butyl 2-(4-formylcyclohexa-2,4-dien-1-yl)acetate.
| Compound Name | tert-butyl 2-(4-formylcyclohexa-2,4-dien-1-yl)acetate |
|---|---|
| PubChem CID | 100933893 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | tert-butyl 2-(4-formylcyclohexa-2,4-dien-1-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CC1C=CC(C=O)=CC1 |
| InChI | InChI=1S/C13H18O3/c1-13(2,3)16-12(15)8-10-4-6-11(9-14)7-5-10/h4,6-7,9-10H,5,8H2,1-3H3 |
| InChIKey | AMKNMFSQZGEVES-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|