C15H22O4 — CID 70835611
tert-butyl 5-(4-hydroxycyclohexa-1,5-dien-1-yl)-3-oxopentanoate (PubChem CID 70835611) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is tert-butyl 5-(4-hydroxycyclohexa-1,5-dien-1-yl)-3-oxopentanoate.
| Compound Name | tert-butyl 5-(4-hydroxycyclohexa-1,5-dien-1-yl)-3-oxopentanoate |
|---|---|
| PubChem CID | 70835611 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | tert-butyl 5-(4-hydroxycyclohexa-1,5-dien-1-yl)-3-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)CC(=O)CCC1=CCC(O)C=C1 |
| InChI | InChI=1S/C15H22O4/c1-15(2,3)19-14(18)10-13(17)9-6-11-4-7-12(16)8-5-11/h4-5,7,12,16H,6,8-10H2,1-3H3 |
| InChIKey | HHQBHYLZCIWTFP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|