C20H25NO4U — CID 147367057
tert-butyl N-[(2S)-1-oxo-3-(4-prop-2-ynoxycyclohexa-1,5-dien-1-yl)propan-2-yl]carbamate;prop-1-yne;uranium(2+) (PubChem CID 147367057) has the molecular formula C20H25NO4U and a molecular weight of 581.45 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-oxo-3-(4-prop-2-ynoxycyclohexa-1,5-dien-1-yl)propan-2-yl]carbamate;prop-1-yne;uranium(2+).
| Compound Name | tert-butyl N-[(2S)-1-oxo-3-(4-prop-2-ynoxycyclohexa-1,5-dien-1-yl)propan-2-yl]carbamate;prop-1-yne;uranium(2+) |
|---|---|
| PubChem CID | 147367057 |
| Molecular Formula | C20H25NO4U |
| Molecular Weight | 581.45 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | tert-butyl N-[(2S)-1-oxo-3-(4-prop-2-ynoxycyclohexa-1,5-dien-1-yl)propan-2-yl]carbamate;prop-1-yne;uranium(2+) |
| SMILES | C#CCOC1C=CC(C[C@@H]([C-]=O)NC(=O)OC(C)(C)C)=CC1.C#C[CH2-].[U+2] |
| InChI | InChI=1S/C17H22NO4.C3H3.U/c1-5-10-21-15-8-6-13(7-9-15)11-14(12-19)18-16(20)22-17(2,3)4;1-3-2;/h1,6-8,14-15H,9-11H2,2-4H3,(H,18,20);1H,2H2;/q2*-1;+2/t14-,15?;;/m0../s1 |
| InChIKey | RQPOIUCOVHLRNW-GJTRSMJBSA-N |
| XLogP | 2.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|