C14H22N2O4 — CID 126625029
tert-butyl N-[(2R)-1-(4-nitrocyclohexa-1,5-dien-1-yl)propan-2-yl]carbamate (PubChem CID 126625029) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(4-nitrocyclohexa-1,5-dien-1-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(4-nitrocyclohexa-1,5-dien-1-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 126625029 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | tert-butyl N-[(2R)-1-(4-nitrocyclohexa-1,5-dien-1-yl)propan-2-yl]carbamate |
| SMILES | C[C@H](CC1=CCC([N+](=O)[O-])C=C1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22N2O4/c1-10(15-13(17)20-14(2,3)4)9-11-5-7-12(8-6-11)16(18)19/h5-7,10,12H,8-9H2,1-4H3,(H,15,17)/t10-,12?/m1/s1 |
| InChIKey | UEUJOSMECSWOQC-RWANSRKNSA-N |
| XLogP | 2.82 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|