C14H21N3O4S — CID 143601446
tert-butyl N-[(2S)-1-amino-3-(4-nitrocyclohexa-2,4-dien-1-yl)-1-sulfanylidenepropan-2-yl]carbamate (PubChem CID 143601446) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-amino-3-(4-nitrocyclohexa-2,4-dien-1-yl)-1-sulfanylidenepropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-amino-3-(4-nitrocyclohexa-2,4-dien-1-yl)-1-sulfanylidenepropan-2-yl]carbamate |
|---|---|
| PubChem CID | 143601446 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | tert-butyl N-[(2S)-1-amino-3-(4-nitrocyclohexa-2,4-dien-1-yl)-1-sulfanylidenepropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1C=CC([N+](=O)[O-])=CC1)C(N)=S |
| InChI | InChI=1S/C14H21N3O4S/c1-14(2,3)21-13(18)16-11(12(15)22)8-9-4-6-10(7-5-9)17(19)20/h4,6-7,9,11H,5,8H2,1-3H3,(H2,15,22)(H,16,18)/t9?,11-/m0/s1 |
| InChIKey | VFZUOFUZJRAOMD-UMJHXOGRSA-N |
| XLogP | 2.29 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|