C15H22N2O6 — CID 174380018
methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrocyclohexa-2,4-dien-1-yl)propanoate (PubChem CID 174380018) has the molecular formula C15H22N2O6 and a molecular weight of 326.35 g/mol. Its IUPAC name is methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrocyclohexa-2,4-dien-1-yl)propanoate.
| Compound Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrocyclohexa-2,4-dien-1-yl)propanoate |
|---|---|
| PubChem CID | 174380018 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrocyclohexa-2,4-dien-1-yl)propanoate |
| SMILES | COC(=O)C(CC1C=CC([N+](=O)[O-])=CC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22N2O6/c1-15(2,3)23-14(19)16-12(13(18)22-4)9-10-5-7-11(8-6-10)17(20)21/h5,7-8,10,12H,6,9H2,1-4H3,(H,16,19) |
| InChIKey | OLPCACCYRHWYKW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|