C13H20ClFN2O2 — CID 175915383
tert-butyl N-[(2R)-1-(4-chloro-6-fluoro-3,4-dihydropyridin-5-yl)propan-2-yl]carbamate (PubChem CID 175915383) has the molecular formula C13H20ClFN2O2 and a molecular weight of 290.77 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(4-chloro-6-fluoro-3,4-dihydropyridin-5-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(4-chloro-6-fluoro-3,4-dihydropyridin-5-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 175915383 |
| Molecular Formula | C13H20ClFN2O2 |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | tert-butyl N-[(2R)-1-(4-chloro-6-fluoro-3,4-dihydropyridin-5-yl)propan-2-yl]carbamate |
| SMILES | C[C@H](CC1=C(F)N=CCC1Cl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20ClFN2O2/c1-8(17-12(18)19-13(2,3)4)7-9-10(14)5-6-16-11(9)15/h6,8,10H,5,7H2,1-4H3,(H,17,18)/t8-,10?/m1/s1 |
| InChIKey | VRSGAHZILGKGKM-HNHGDDPOSA-N |
| XLogP | 3.55 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|