C14H21FN2O2 — CID 177040114
tert-butyl N-[1-(2-fluoro-4-methyl-3-pyridinyl)propan-2-yl]carbamate (PubChem CID 177040114) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is tert-butyl N-[1-(2-fluoro-4-methyl-3-pyridinyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-fluoro-4-methyl-3-pyridinyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 177040114 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | tert-butyl N-[1-(2-fluoro-4-methyl-3-pyridinyl)propan-2-yl]carbamate |
| SMILES | Cc1ccnc(F)c1CC(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21FN2O2/c1-9-6-7-16-12(15)11(9)8-10(2)17-13(18)19-14(3,4)5/h6-7,10H,8H2,1-5H3,(H,17,18) |
| InChIKey | XTTJFFJMDKBWNB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|