C16H26N2O4 — CID 169013132
tert-butyl N-[1-[4-(dimethoxymethyl)-3-pyridinyl]propan-2-yl]carbamate (PubChem CID 169013132) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(dimethoxymethyl)-3-pyridinyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(dimethoxymethyl)-3-pyridinyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 169013132 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | tert-butyl N-[1-[4-(dimethoxymethyl)-3-pyridinyl]propan-2-yl]carbamate |
| SMILES | COC(OC)c1ccncc1CC(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26N2O4/c1-11(18-15(19)22-16(2,3)4)9-12-10-17-8-7-13(12)14(20-5)21-6/h7-8,10-11,14H,9H2,1-6H3,(H,18,19) |
| InChIKey | LYCRIYKTAQYYQM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|