C13H17NO2 — CID 129171804
tert-butyl N-(4-ethynylcyclohexa-2,4-dien-1-yl)carbamate (PubChem CID 129171804) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is tert-butyl N-(4-ethynylcyclohexa-2,4-dien-1-yl)carbamate.
| Compound Name | tert-butyl N-(4-ethynylcyclohexa-2,4-dien-1-yl)carbamate |
|---|---|
| PubChem CID | 129171804 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | tert-butyl N-(4-ethynylcyclohexa-2,4-dien-1-yl)carbamate |
| SMILES | C#CC1=CCC(NC(=O)OC(C)(C)C)C=C1 |
| InChI | InChI=1S/C13H17NO2/c1-5-10-6-8-11(9-7-10)14-12(15)16-13(2,3)4/h1,6-8,11H,9H2,2-4H3,(H,14,15) |
| InChIKey | SGPZXYHIZZSXEC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|