C10H15ClN2O2 — CID 139419498
tert-butyl N-(6-chloro-3,4-dihydropyridin-4-yl)carbamate (PubChem CID 139419498) has the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. Its IUPAC name is tert-butyl N-(6-chloro-3,4-dihydropyridin-4-yl)carbamate.
| Compound Name | tert-butyl N-(6-chloro-3,4-dihydropyridin-4-yl)carbamate |
|---|---|
| PubChem CID | 139419498 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | tert-butyl N-(6-chloro-3,4-dihydropyridin-4-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C=C(Cl)N=CC1 |
| InChI | InChI=1S/C10H15ClN2O2/c1-10(2,3)15-9(14)13-7-4-5-12-8(11)6-7/h5-7H,4H2,1-3H3,(H,13,14) |
| InChIKey | JMYOMOMKZJGIQS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|