C16H31NO3Si — CID 25112436
tert-butyl N-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]carbamate (PubChem CID 25112436) has the molecular formula C16H31NO3Si and a molecular weight of 313.51 g/mol. Its IUPAC name is tert-butyl N-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]carbamate |
|---|---|
| PubChem CID | 25112436 |
| Molecular Formula | C16H31NO3Si |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | tert-butyl N-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C=C[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C16H31NO3Si/c1-15(2,3)19-14(18)17-12-9-10-13(11-12)20-21(7,8)16(4,5)6/h9-10,12-13H,11H2,1-8H3,(H,17,18)/t12-,13+/m0/s1 |
| InChIKey | XZKIBXPJNGMUNI-QWHCGFSZSA-N |
| XLogP | 4.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|