C12H21NO5S — CID 71163238
tert-butyl N-[(1S,4R)-4-[hydroxy(methylsulfonyl)methyl]cyclopent-2-en-1-yl]carbamate (PubChem CID 71163238) has the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R)-4-[hydroxy(methylsulfonyl)methyl]cyclopent-2-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R)-4-[hydroxy(methylsulfonyl)methyl]cyclopent-2-en-1-yl]carbamate |
|---|---|
| PubChem CID | 71163238 |
| Molecular Formula | C12H21NO5S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | tert-butyl N-[(1S,4R)-4-[hydroxy(methylsulfonyl)methyl]cyclopent-2-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C=C[C@H](C(O)S(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H21NO5S/c1-12(2,3)18-11(15)13-9-6-5-8(7-9)10(14)19(4,16)17/h5-6,8-10,14H,7H2,1-4H3,(H,13,15)/t8-,9+,10?/m0/s1 |
| InChIKey | YLNMMBHSROLBQW-QIIDTADFSA-N |
| XLogP | 0.82 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|