C14H25NO4 — CID 177424766
tert-butyl N-[(2S)-2,3-dihydroxy-1-(4-methylcyclopent-2-en-1-yl)propyl]carbamate (PubChem CID 177424766) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2,3-dihydroxy-1-(4-methylcyclopent-2-en-1-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2,3-dihydroxy-1-(4-methylcyclopent-2-en-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 177424766 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | tert-butyl N-[(2S)-2,3-dihydroxy-1-(4-methylcyclopent-2-en-1-yl)propyl]carbamate |
| SMILES | CC1C=CC(C(NC(=O)OC(C)(C)C)[C@H](O)CO)C1 |
| InChI | InChI=1S/C14H25NO4/c1-9-5-6-10(7-9)12(11(17)8-16)15-13(18)19-14(2,3)4/h5-6,9-12,16-17H,7-8H2,1-4H3,(H,15,18)/t9?,10?,11-,12?/m1/s1 |
| InChIKey | NULXGWSMKIIPLQ-QDLLBCNESA-N |
| XLogP | 1.45 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|