C16H23ClN4O2 — CID 129216670
tert-butyl N-[3-(6-chloropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]carbamate (PubChem CID 129216670) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is tert-butyl N-[3-(6-chloropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]carbamate.
| Compound Name | tert-butyl N-[3-(6-chloropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]carbamate |
|---|---|
| PubChem CID | 129216670 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | tert-butyl N-[3-(6-chloropyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C2CCC1CN(c1cc(Cl)ncn1)C2 |
| InChI | InChI=1S/C16H23ClN4O2/c1-16(2,3)23-15(22)20-14-10-4-5-11(14)8-21(7-10)13-6-12(17)18-9-19-13/h6,9-11,14H,4-5,7-8H2,1-3H3,(H,20,22) |
| InChIKey | SUMISCXJFBKMHT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |