C19H20Cl2F2N4O2 — CID 86609209
tert-butyl N-[(3R,4S)-4-(2-chloro-4,5-difluorophenyl)-1-(6-chloropyrimidin-4-yl)pyrrolidin-3-yl]carbamate (PubChem CID 86609209) has the molecular formula C19H20Cl2F2N4O2 and a molecular weight of 445.30 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-4-(2-chloro-4,5-difluorophenyl)-1-(6-chloropyrimidin-4-yl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S)-4-(2-chloro-4,5-difluorophenyl)-1-(6-chloropyrimidin-4-yl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86609209 |
| Molecular Formula | C19H20Cl2F2N4O2 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | tert-butyl N-[(3R,4S)-4-(2-chloro-4,5-difluorophenyl)-1-(6-chloropyrimidin-4-yl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CN(c2cc(Cl)ncn2)C[C@@H]1c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C19H20Cl2F2N4O2/c1-19(2,3)29-18(28)26-15-8-27(17-6-16(21)24-9-25-17)7-11(15)10-4-13(22)14(23)5-12(10)20/h4-6,9,11,15H,7-8H2,1-3H3,(H,26,28)/t11-,15+/m1/s1 |
| InChIKey | BDVPZMCOOKUNKX-ABAIWWIYSA-N |
| XLogP | 4.56 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|