C14H21ClN4O2 — CID 71632384
tert-butyl N-[[1-(6-chloropyrimidin-4-yl)pyrrolidin-2-yl]methyl]carbamate (PubChem CID 71632384) has the molecular formula C14H21ClN4O2 and a molecular weight of 312.80 g/mol. Its IUPAC name is tert-butyl N-[[1-(6-chloropyrimidin-4-yl)pyrrolidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(6-chloropyrimidin-4-yl)pyrrolidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 71632384 |
| Molecular Formula | C14H21ClN4O2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | tert-butyl N-[[1-(6-chloropyrimidin-4-yl)pyrrolidin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCN1c1cc(Cl)ncn1 |
| InChI | InChI=1S/C14H21ClN4O2/c1-14(2,3)21-13(20)16-8-10-5-4-6-19(10)12-7-11(15)17-9-18-12/h7,9-10H,4-6,8H2,1-3H3,(H,16,20) |
| InChIKey | PHBGXLZWPAYQDF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |