C15H24ClN5O2 — CID 133397090
tert-butyl N-[[1-(2-amino-6-chloropyrimidin-4-yl)piperidin-2-yl]methyl]carbamate (PubChem CID 133397090) has the molecular formula C15H24ClN5O2 and a molecular weight of 341.84 g/mol. Its IUPAC name is tert-butyl N-[[1-(2-amino-6-chloropyrimidin-4-yl)piperidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(2-amino-6-chloropyrimidin-4-yl)piperidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 133397090 |
| Molecular Formula | C15H24ClN5O2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | tert-butyl N-[[1-(2-amino-6-chloropyrimidin-4-yl)piperidin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCCN1c1cc(Cl)nc(N)n1 |
| InChI | InChI=1S/C15H24ClN5O2/c1-15(2,3)23-14(22)18-9-10-6-4-5-7-21(10)12-8-11(16)19-13(17)20-12/h8,10H,4-7,9H2,1-3H3,(H,18,22)(H2,17,19,20) |
| InChIKey | PNDUMNBSXLSGPF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |