C12H18NO4- — CID 91827558
(1S,4R)-1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate (PubChem CID 91827558) has the molecular formula C12H18NO4- and a molecular weight of 240.28 g/mol. Its IUPAC name is (1S,4R)-1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate.
| Compound Name | (1S,4R)-1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 91827558 |
| Molecular Formula | C12H18NO4- |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (1S,4R)-1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C=C[C@@](C)(C(=O)[O-])C1 |
| InChI | InChI=1S/C12H19NO4/c1-11(2,3)17-10(16)13-8-5-6-12(4,7-8)9(14)15/h5-6,8H,7H2,1-4H3,(H,13,16)(H,14,15)/p-1/t8-,12+/m0/s1 |
| InChIKey | QRMRTMWCYAQNRV-QPUJVOFHSA-M |
| XLogP | 0.60 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|