C13H21NO2 — CID 167486060
tert-butyl 2-(5-ethyl-2,3-dihydropyridin-3-yl)acetate (PubChem CID 167486060) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is tert-butyl 2-(5-ethyl-2,3-dihydropyridin-3-yl)acetate.
| Compound Name | tert-butyl 2-(5-ethyl-2,3-dihydropyridin-3-yl)acetate |
|---|---|
| PubChem CID | 167486060 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | tert-butyl 2-(5-ethyl-2,3-dihydropyridin-3-yl)acetate |
| SMILES | CCC1=CC(CC(=O)OC(C)(C)C)CN=C1 |
| InChI | InChI=1S/C13H21NO2/c1-5-10-6-11(9-14-8-10)7-12(15)16-13(2,3)4/h6,8,11H,5,7,9H2,1-4H3 |
| InChIKey | PQYVKRJWUNEUMI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |