About tert-butyl 4-ethyl-2-methylcyclohexa-2,4-diene-1-carboxylate
tert-butyl 4-ethyl-2-methylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 130217503) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is tert-butyl 4-ethyl-2-methylcyclohexa-2,4-diene-1-carboxylate.
Analyze tert-butyl 4-ethyl-2-methylcyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-ethyl-2-methylcyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of tert-butyl 4-ethyl-2-methylcyclohexa-2,4-diene-1-carboxylate (CID 130217503) is tert-butyl 4-ethyl-2-methylcyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for tert-butyl 4-ethyl-2-methylcyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for tert-butyl 4-ethyl-2-methylcyclohexa-2,4-diene-1-carboxylate is CCC1=CCC(C(=O)OC(C)(C)C)C(C)=C1.
What is the InChIKey of tert-butyl 4-ethyl-2-methylcyclohexa-2,4-diene-1-carboxylate?
The InChIKey is CKGJVUZNXLHUKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-6-11-7-8-12(10(2)9-11)13(15)16-14(3,4)5/h7,9,12H,6,8H2,1-5H3.
What are the key properties of tert-butyl 4-ethyl-2-methylcyclohexa-2,4-diene-1-carboxylate?
tert-butyl 4-ethyl-2-methylcyclohexa-2,4-diene-1-carboxylate has a molecular weight of 222.33 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-ethyl-2-methylcyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 130217503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).