C12H20O5 — CID 142258058
tert-butyl 2-(6-ethyl-2-oxo-1,3-dioxan-4-yl)acetate (PubChem CID 142258058) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is tert-butyl 2-(6-ethyl-2-oxo-1,3-dioxan-4-yl)acetate.
| Compound Name | tert-butyl 2-(6-ethyl-2-oxo-1,3-dioxan-4-yl)acetate |
|---|---|
| PubChem CID | 142258058 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | tert-butyl 2-(6-ethyl-2-oxo-1,3-dioxan-4-yl)acetate |
| SMILES | CCC1CC(CC(=O)OC(C)(C)C)OC(=O)O1 |
| InChI | InChI=1S/C12H20O5/c1-5-8-6-9(16-11(14)15-8)7-10(13)17-12(2,3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | ATMCMARJOWCERR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |