C11H18IO5+ — CID 142258057
[(4S,6R)-4-(iodomethyl)-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-2-ylidene]oxidanium (PubChem CID 142258057) has the molecular formula C11H18IO5+ and a molecular weight of 357.16 g/mol. Its IUPAC name is [(4S,6R)-4-(iodomethyl)-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-2-ylidene]oxidanium.
| Compound Name | [(4S,6R)-4-(iodomethyl)-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-2-ylidene]oxidanium |
|---|---|
| PubChem CID | 142258057 |
| Molecular Formula | C11H18IO5+ |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | [(4S,6R)-4-(iodomethyl)-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-2-ylidene]oxidanium |
| SMILES | [H]/[O+]=C1\O[C@H](CI)C[C@H](CC(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C11H17IO5/c1-11(2,3)17-9(13)5-7-4-8(6-12)16-10(14)15-7/h7-8H,4-6H2,1-3H3/p+1/t7-,8+/m1/s1 |
| InChIKey | LWXWWQJKHFJRAB-SFYZADRCSA-O |
| XLogP | 1.79 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|