C14H27INO4P — CID 143797406
tert-butyl 2-[(4R,6R)-6-[2-[iodo(phosphanyl)amino]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 143797406) has the molecular formula C14H27INO4P and a molecular weight of 431.25 g/mol. Its IUPAC name is tert-butyl 2-[(4R,6R)-6-[2-[iodo(phosphanyl)amino]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,6R)-6-[2-[iodo(phosphanyl)amino]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 143797406 |
| Molecular Formula | C14H27INO4P |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | tert-butyl 2-[(4R,6R)-6-[2-[iodo(phosphanyl)amino]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1C[C@@H](CCN(P)I)OC(C)(C)O1 |
| InChI | InChI=1S/C14H27INO4P/c1-13(2,3)20-12(17)9-11-8-10(6-7-16(15)21)18-14(4,5)19-11/h10-11H,6-9,21H2,1-5H3/t10-,11-/m1/s1 |
| InChIKey | WEUPEYNZFFLQIE-GHMZBOCLSA-N |
| XLogP | 3.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|