C14H23F3O7S — CID 21357616
tert-butyl 2-[2,2-dimethyl-6-(trifluoromethylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetate (PubChem CID 21357616) has the molecular formula C14H23F3O7S and a molecular weight of 392.39 g/mol. Its IUPAC name is tert-butyl 2-[2,2-dimethyl-6-(trifluoromethylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[2,2-dimethyl-6-(trifluoromethylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 21357616 |
| Molecular Formula | C14H23F3O7S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | tert-butyl 2-[2,2-dimethyl-6-(trifluoromethylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CC(COS(=O)(=O)C(F)(F)F)OC(C)(C)O1 |
| InChI | InChI=1S/C14H23F3O7S/c1-12(2,3)24-11(18)7-9-6-10(23-13(4,5)22-9)8-21-25(19,20)14(15,16)17/h9-10H,6-8H2,1-5H3 |
| InChIKey | QDSPVWHCPJGSRB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|