C27H50O12S — CID 162099397
tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-(methylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetate;tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 162099397) has the molecular formula C27H50O12S and a molecular weight of 598.75 g/mol. Its IUPAC name is tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-(methylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetate;tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-(methylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetate;tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 162099397 |
| Molecular Formula | C27H50O12S |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | tert-butyl 2-[(4R,6S)-2,2-dimethyl-6-(methylsulfonyloxymethyl)-1,3-dioxan-4-yl]acetate;tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1C[C@@H](CO)OC(C)(C)O1.CC(C)(C)OC(=O)C[C@H]1C[C@@H](COS(C)(=O)=O)OC(C)(C)O1 |
| InChI | InChI=1S/C14H26O7S.C13H24O5/c1-13(2,3)21-12(15)8-10-7-11(9-18-22(6,16)17)20-14(4,5)19-10;1-12(2,3)18-11(15)7-9-6-10(8-14)17-13(4,5)16-9/h10-11H,7-9H2,1-6H3;9-10,14H,6-8H2,1-5H3/t10-,11+;9-,10+/m11/s1 |
| InChIKey | ZERHWMALTNDHKV-USZFFVPSSA-N |
| XLogP | 3.23 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|