C28H50O11 — CID 158405123
tert-butyl 2-[(4R,6S)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate;tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 158405123) has the molecular formula C28H50O11 and a molecular weight of 562.70 g/mol. Its IUPAC name is tert-butyl 2-[(4R,6S)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate;tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,6S)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate;tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 158405123 |
| Molecular Formula | C28H50O11 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.34 |
| IUPAC Name | tert-butyl 2-[(4R,6S)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate;tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | CC(=O)OC[C@@H]1C[C@H](CC(=O)OC(C)(C)C)OC(C)(C)O1.CC(C)(C)OC(=O)C[C@H]1C[C@@H](CO)OC(C)(C)O1 |
| InChI | InChI=1S/C15H26O6.C13H24O5/c1-10(16)18-9-12-7-11(19-15(5,6)20-12)8-13(17)21-14(2,3)4;1-12(2,3)18-11(15)7-9-6-10(8-14)17-13(4,5)16-9/h11-12H,7-9H2,1-6H3;9-10,14H,6-8H2,1-5H3/t11-,12+;9-,10+/m11/s1 |
| InChIKey | GYPBBZDXMWRILE-AYRXSNLJSA-N |
| XLogP | 3.81 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|