C11H18BO6- — CID 140775769
tert-butyl 2-[(7S)-3-oxo-1,4,6-trioxa-5-boranuidaspiro[4.4]nonan-7-yl]acetate (PubChem CID 140775769) has the molecular formula C11H18BO6- and a molecular weight of 257.07 g/mol. Its IUPAC name is tert-butyl 2-[(7S)-3-oxo-1,4,6-trioxa-5-boranuidaspiro[4.4]nonan-7-yl]acetate.
| Compound Name | tert-butyl 2-[(7S)-3-oxo-1,4,6-trioxa-5-boranuidaspiro[4.4]nonan-7-yl]acetate |
|---|---|
| PubChem CID | 140775769 |
| Molecular Formula | C11H18BO6- |
| Molecular Weight | 257.07 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | tert-butyl 2-[(7S)-3-oxo-1,4,6-trioxa-5-boranuidaspiro[4.4]nonan-7-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@H]1CC[B-]2(OCC(=O)O2)O1 |
| InChI | InChI=1S/C11H18BO6/c1-11(2,3)16-9(13)6-8-4-5-12(17-8)15-7-10(14)18-12/h8H,4-7H2,1-3H3/q-1/t8-,12?/m0/s1 |
| InChIKey | KRXKSGWWNONLQS-KBPLZSHQSA-N |
| XLogP | 1.02 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.07 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|