C12H18INO6 — CID 18380404
2-[5-(iodomethyl)-2-oxooxolan-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (PubChem CID 18380404) has the molecular formula C12H18INO6 and a molecular weight of 399.18 g/mol. Its IUPAC name is 2-[5-(iodomethyl)-2-oxooxolan-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid.
| Compound Name | 2-[5-(iodomethyl)-2-oxooxolan-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 18380404 |
| Molecular Formula | C12H18INO6 |
| Molecular Weight | 399.18 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 2-[5-(iodomethyl)-2-oxooxolan-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C1CC(CI)OC1=O |
| InChI | InChI=1S/C12H18INO6/c1-12(2,3)20-11(18)14-8(9(15)16)7-4-6(5-13)19-10(7)17/h6-8H,4-5H2,1-3H3,(H,14,18)(H,15,16) |
| InChIKey | BZEHXVRCEIEBAT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|