C12H19NO6 — CID 14704480
[(2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxooxolan-2-yl]methyl acetate (PubChem CID 14704480) has the molecular formula C12H19NO6 and a molecular weight of 273.29 g/mol. Its IUPAC name is [(2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxooxolan-2-yl]methyl acetate.
| Compound Name | [(2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxooxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14704480 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | [(2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxooxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C[C@H](NC(=O)OC(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C12H19NO6/c1-7(14)17-6-8-5-9(10(15)18-8)13-11(16)19-12(2,3)4/h8-9H,5-6H2,1-4H3,(H,13,16)/t8-,9-/m0/s1 |
| InChIKey | PFLTWTDBKFZRDR-IUCAKERBSA-N |
| XLogP | 0.76 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|