C14H21NO8 — CID 10903659
methyl (2S)-2-acetyloxy-2-[(2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxooxolan-2-yl]acetate (PubChem CID 10903659) has the molecular formula C14H21NO8 and a molecular weight of 331.32 g/mol. Its IUPAC name is methyl (2S)-2-acetyloxy-2-[(2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxooxolan-2-yl]acetate.
| Compound Name | methyl (2S)-2-acetyloxy-2-[(2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxooxolan-2-yl]acetate |
|---|---|
| PubChem CID | 10903659 |
| Molecular Formula | C14H21NO8 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | methyl (2S)-2-acetyloxy-2-[(2S,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxooxolan-2-yl]acetate |
| SMILES | COC(=O)[C@@H](OC(C)=O)[C@H]1OC(=O)C[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21NO8/c1-7(16)21-11(12(18)20-5)10-8(6-9(17)22-10)15-13(19)23-14(2,3)4/h8,10-11H,6H2,1-5H3,(H,15,19)/t8-,10-,11-/m0/s1 |
| InChIKey | NUMTYTHAFFLOLJ-LSJOCFKGSA-N |
| XLogP | 0.30 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|