C16H25NO7 — CID 171467689
tert-butyl 2-[5-[2-(tert-butylamino)-2-oxoethyl]-3,6-dioxo-1,4-dioxan-2-yl]acetate (PubChem CID 171467689) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is tert-butyl 2-[5-[2-(tert-butylamino)-2-oxoethyl]-3,6-dioxo-1,4-dioxan-2-yl]acetate.
| Compound Name | tert-butyl 2-[5-[2-(tert-butylamino)-2-oxoethyl]-3,6-dioxo-1,4-dioxan-2-yl]acetate |
|---|---|
| PubChem CID | 171467689 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | tert-butyl 2-[5-[2-(tert-butylamino)-2-oxoethyl]-3,6-dioxo-1,4-dioxan-2-yl]acetate |
| SMILES | CC(C)(C)NC(=O)CC1OC(=O)C(CC(=O)OC(C)(C)C)OC1=O |
| InChI | InChI=1S/C16H25NO7/c1-15(2,3)17-11(18)7-9-13(20)23-10(14(21)22-9)8-12(19)24-16(4,5)6/h9-10H,7-8H2,1-6H3,(H,17,18) |
| InChIKey | DMDMWASDYKNPFH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|