C13H20O5 — CID 141113775
tert-butyl 2-(5-formyl-2,2-dimethyl-4H-1,3-dioxin-4-yl)acetate (PubChem CID 141113775) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is tert-butyl 2-(5-formyl-2,2-dimethyl-4H-1,3-dioxin-4-yl)acetate.
| Compound Name | tert-butyl 2-(5-formyl-2,2-dimethyl-4H-1,3-dioxin-4-yl)acetate |
|---|---|
| PubChem CID | 141113775 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | tert-butyl 2-(5-formyl-2,2-dimethyl-4H-1,3-dioxin-4-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CC1OC(C)(C)OC=C1C=O |
| InChI | InChI=1S/C13H20O5/c1-12(2,3)18-11(15)6-10-9(7-14)8-16-13(4,5)17-10/h7-8,10H,6H2,1-5H3 |
| InChIKey | ZXJVCXGFEUDKMJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|