C17H22BNO4 — CID 129404080
tert-butyl 2-[(4S,6S)-6-(cyanomethyl)-2-phenyl-1,3,2-dioxaborinan-4-yl]acetate (PubChem CID 129404080) has the molecular formula C17H22BNO4 and a molecular weight of 315.18 g/mol. Its IUPAC name is tert-butyl 2-[(4S,6S)-6-(cyanomethyl)-2-phenyl-1,3,2-dioxaborinan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4S,6S)-6-(cyanomethyl)-2-phenyl-1,3,2-dioxaborinan-4-yl]acetate |
|---|---|
| PubChem CID | 129404080 |
| Molecular Formula | C17H22BNO4 |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | tert-butyl 2-[(4S,6S)-6-(cyanomethyl)-2-phenyl-1,3,2-dioxaborinan-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@H]1C[C@H](CC#N)OB(c2ccccc2)O1 |
| InChI | InChI=1S/C17H22BNO4/c1-17(2,3)21-16(20)12-15-11-14(9-10-19)22-18(23-15)13-7-5-4-6-8-13/h4-8,14-15H,9,11-12H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | IQJDRZRUUOWNER-GJZGRUSLSA-N |
| XLogP | 2.20 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|