C12H18O8 — CID 90184256
[(2E)-6,7-dihydroxy-4-methoxycarbonyloxycyclooct-2-en-1-yl] methyl carbonate (PubChem CID 90184256) has the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. Its IUPAC name is [(2E)-6,7-dihydroxy-4-methoxycarbonyloxycyclooct-2-en-1-yl] methyl carbonate.
| Compound Name | [(2E)-6,7-dihydroxy-4-methoxycarbonyloxycyclooct-2-en-1-yl] methyl carbonate |
|---|---|
| PubChem CID | 90184256 |
| Molecular Formula | C12H18O8 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | [(2E)-6,7-dihydroxy-4-methoxycarbonyloxycyclooct-2-en-1-yl] methyl carbonate |
| SMILES | COC(=O)OC1/C=C\C(OC(=O)OC)CC(O)C(O)C1 |
| InChI | InChI=1S/C12H18O8/c1-17-11(15)19-7-3-4-8(20-12(16)18-2)6-10(14)9(13)5-7/h3-4,7-10,13-14H,5-6H2,1-2H3/b4-3- |
| InChIKey | DEUDRVHAXYJOKK-ARJAWSKDSA-N |
| XLogP | 0.36 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|