C10H16N2O5 — CID 144632180
[(2E)-4-carbamoyloxy-6-hydroxycyclooct-2-en-1-yl] carbamate (PubChem CID 144632180) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is [(2E)-4-carbamoyloxy-6-hydroxycyclooct-2-en-1-yl] carbamate.
| Compound Name | [(2E)-4-carbamoyloxy-6-hydroxycyclooct-2-en-1-yl] carbamate |
|---|---|
| PubChem CID | 144632180 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | [(2E)-4-carbamoyloxy-6-hydroxycyclooct-2-en-1-yl] carbamate |
| SMILES | NC(=O)OC1/C=C\C(OC(N)=O)CC(O)CC1 |
| InChI | InChI=1S/C10H16N2O5/c11-9(14)16-7-2-1-6(13)5-8(4-3-7)17-10(12)15/h3-4,6-8,13H,1-2,5H2,(H2,11,14)(H2,12,15)/b4-3- |
| InChIKey | VETRPYWPNLCGEK-ARJAWSKDSA-N |
| XLogP | 0.02 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|