C11H17NO4 — CID 177224563
methyl (1S,4E,6S)-6-carbamoyloxycyclooct-4-ene-1-carboxylate (PubChem CID 177224563) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl (1S,4E,6S)-6-carbamoyloxycyclooct-4-ene-1-carboxylate.
| Compound Name | methyl (1S,4E,6S)-6-carbamoyloxycyclooct-4-ene-1-carboxylate |
|---|---|
| PubChem CID | 177224563 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | methyl (1S,4E,6S)-6-carbamoyloxycyclooct-4-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC/C=C\[C@@H](OC(N)=O)CC1 |
| InChI | InChI=1S/C11H17NO4/c1-15-10(13)8-4-2-3-5-9(7-6-8)16-11(12)14/h3,5,8-9H,2,4,6-7H2,1H3,(H2,12,14)/b5-3-/t8-,9+/m0/s1 |
| InChIKey | BEXVUVCKFHYBAD-LPMXFETPSA-N |
| XLogP | 1.37 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|