C18H30O3S — CID 118458936
[(2E)-6-(2,2-dimethylpropanoyl)cyclooct-2-en-1-yl] tert-butylsulfanylformate (PubChem CID 118458936) has the molecular formula C18H30O3S and a molecular weight of 326.50 g/mol. Its IUPAC name is [(2E)-6-(2,2-dimethylpropanoyl)cyclooct-2-en-1-yl] tert-butylsulfanylformate.
| Compound Name | [(2E)-6-(2,2-dimethylpropanoyl)cyclooct-2-en-1-yl] tert-butylsulfanylformate |
|---|---|
| PubChem CID | 118458936 |
| Molecular Formula | C18H30O3S |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [(2E)-6-(2,2-dimethylpropanoyl)cyclooct-2-en-1-yl] tert-butylsulfanylformate |
| SMILES | CC(C)(C)SC(=O)OC1/C=C\CCC(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H30O3S/c1-17(2,3)15(19)13-9-7-8-10-14(12-11-13)21-16(20)22-18(4,5)6/h8,10,13-14H,7,9,11-12H2,1-6H3/b10-8- |
| InChIKey | KSGWZAKNMAQFKK-NTMALXAHSA-N |
| XLogP | 5.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|