C13H22O3S — CID 118458928
[(2E)-6-hydroxycyclooct-2-en-1-yl] tert-butylsulfanylformate (PubChem CID 118458928) has the molecular formula C13H22O3S and a molecular weight of 258.38 g/mol. Its IUPAC name is [(2E)-6-hydroxycyclooct-2-en-1-yl] tert-butylsulfanylformate.
| Compound Name | [(2E)-6-hydroxycyclooct-2-en-1-yl] tert-butylsulfanylformate |
|---|---|
| PubChem CID | 118458928 |
| Molecular Formula | C13H22O3S |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [(2E)-6-hydroxycyclooct-2-en-1-yl] tert-butylsulfanylformate |
| SMILES | CC(C)(C)SC(=O)OC1/C=C\CCC(O)CC1 |
| InChI | InChI=1S/C13H22O3S/c1-13(2,3)17-12(15)16-11-7-5-4-6-10(14)8-9-11/h5,7,10-11,14H,4,6,8-9H2,1-3H3/b7-5- |
| InChIKey | WLUYRQDJGWICED-ALCCZGGFSA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|