C17H32N2O2 — CID 118458934
[(2E)-6-(tert-butylamino)cyclooct-2-en-1-yl] N-tert-butylcarbamate (PubChem CID 118458934) has the molecular formula C17H32N2O2 and a molecular weight of 296.46 g/mol. Its IUPAC name is [(2E)-6-(tert-butylamino)cyclooct-2-en-1-yl] N-tert-butylcarbamate.
| Compound Name | [(2E)-6-(tert-butylamino)cyclooct-2-en-1-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 118458934 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | [(2E)-6-(tert-butylamino)cyclooct-2-en-1-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1/C=C\CCC(NC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H32N2O2/c1-16(2,3)18-13-9-7-8-10-14(12-11-13)21-15(20)19-17(4,5)6/h8,10,13-14,18H,7,9,11-12H2,1-6H3,(H,19,20)/b10-8- |
| InChIKey | HPFZYNIHKGGLBK-NTMALXAHSA-N |
| XLogP | 3.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|