C9H15IN2O2 — CID 174338322
[(2E)-6-aminocyclooct-2-en-1-yl] N-iodocarbamate (PubChem CID 174338322) has the molecular formula C9H15IN2O2 and a molecular weight of 310.14 g/mol. Its IUPAC name is [(2E)-6-aminocyclooct-2-en-1-yl] N-iodocarbamate.
| Compound Name | [(2E)-6-aminocyclooct-2-en-1-yl] N-iodocarbamate |
|---|---|
| PubChem CID | 174338322 |
| Molecular Formula | C9H15IN2O2 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | [(2E)-6-aminocyclooct-2-en-1-yl] N-iodocarbamate |
| SMILES | NC1CC/C=C\C(OC(=O)NI)CC1 |
| InChI | InChI=1S/C9H15IN2O2/c10-12-9(13)14-8-4-2-1-3-7(11)5-6-8/h2,4,7-8H,1,3,5-6,11H2,(H,12,13)/b4-2- |
| InChIKey | AQMUUSWQZPEYIY-RQOWECAXSA-N |
| XLogP | 1.89 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|