C16H35NO2S — CID 144632126
ethane;[(2E)-6-(methylamino)cyclooct-2-en-1-yl]oxymethanethioic S-acid (PubChem CID 144632126) has the molecular formula C16H35NO2S and a molecular weight of 305.53 g/mol. Its IUPAC name is ethane;[(2E)-6-(methylamino)cyclooct-2-en-1-yl]oxymethanethioic S-acid.
| Compound Name | ethane;[(2E)-6-(methylamino)cyclooct-2-en-1-yl]oxymethanethioic S-acid |
|---|---|
| PubChem CID | 144632126 |
| Molecular Formula | C16H35NO2S |
| Molecular Weight | 305.53 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | ethane;[(2E)-6-(methylamino)cyclooct-2-en-1-yl]oxymethanethioic S-acid |
| SMILES | CC.CC.CC.CNC1CC/C=C\C(OC(=O)S)CC1 |
| InChI | InChI=1S/C10H17NO2S.3C2H6/c1-11-8-4-2-3-5-9(7-6-8)13-10(12)14;3*1-2/h3,5,8-9,11H,2,4,6-7H2,1H3,(H,12,14);3*1-2H3/b5-3-;;; |
| InChIKey | BGSFXUMIBCPLAN-FEMJVSHYSA-N |
| XLogP | 5.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|