C9H12O3S — CID 123416586
(5-oxocyclooct-2-en-1-yl)oxymethanethioic S-acid (PubChem CID 123416586) has the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. Its IUPAC name is (5-oxocyclooct-2-en-1-yl)oxymethanethioic S-acid.
| Compound Name | (5-oxocyclooct-2-en-1-yl)oxymethanethioic S-acid |
|---|---|
| PubChem CID | 123416586 |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | (5-oxocyclooct-2-en-1-yl)oxymethanethioic S-acid |
| SMILES | O=C1CC=CC(OC(=O)S)CCC1 |
| InChI | InChI=1S/C9H12O3S/c10-7-3-1-5-8(6-2-4-7)12-9(11)13/h1,5,8H,2-4,6H2,(H,11,13) |
| InChIKey | GXRSISYABLDIGF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|