C11H16O3S — CID 118550636
[(2E)-6-oxocyclooct-2-en-1-yl] ethylsulfanylformate (PubChem CID 118550636) has the molecular formula C11H16O3S and a molecular weight of 228.31 g/mol. Its IUPAC name is [(2E)-6-oxocyclooct-2-en-1-yl] ethylsulfanylformate.
| Compound Name | [(2E)-6-oxocyclooct-2-en-1-yl] ethylsulfanylformate |
|---|---|
| PubChem CID | 118550636 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | [(2E)-6-oxocyclooct-2-en-1-yl] ethylsulfanylformate |
| SMILES | CCSC(=O)OC1/C=C\CCC(=O)CC1 |
| InChI | InChI=1S/C11H16O3S/c1-2-15-11(13)14-10-6-4-3-5-9(12)7-8-10/h4,6,10H,2-3,5,7-8H2,1H3/b6-4- |
| InChIKey | QVTJUBRCWBYUEE-XQRVVYSFSA-N |
| XLogP | 2.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|