C15H26O3S — CID 122495990
[(2E)-8-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] ethylsulfanylformate (PubChem CID 122495990) has the molecular formula C15H26O3S and a molecular weight of 286.44 g/mol. Its IUPAC name is [(2E)-8-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] ethylsulfanylformate.
| Compound Name | [(2E)-8-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] ethylsulfanylformate |
|---|---|
| PubChem CID | 122495990 |
| Molecular Formula | C15H26O3S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [(2E)-8-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] ethylsulfanylformate |
| SMILES | CCSC(=O)OC1/C=C\CCCCC1OC(C)(C)C |
| InChI | InChI=1S/C15H26O3S/c1-5-19-14(16)17-12-10-8-6-7-9-11-13(12)18-15(2,3)4/h8,10,12-13H,5-7,9,11H2,1-4H3/b10-8- |
| InChIKey | XOMJYLGTTXICAH-NTMALXAHSA-N |
| XLogP | 4.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|