C16H28N2O3 — CID 118460764
[(2E)-8-[2-(tert-butylamino)-2-oxoethyl]cyclooct-2-en-1-yl] N-methylcarbamate (PubChem CID 118460764) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is [(2E)-8-[2-(tert-butylamino)-2-oxoethyl]cyclooct-2-en-1-yl] N-methylcarbamate.
| Compound Name | [(2E)-8-[2-(tert-butylamino)-2-oxoethyl]cyclooct-2-en-1-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 118460764 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | [(2E)-8-[2-(tert-butylamino)-2-oxoethyl]cyclooct-2-en-1-yl] N-methylcarbamate |
| SMILES | CNC(=O)OC1/C=C\CCCCC1CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H28N2O3/c1-16(2,3)18-14(19)11-12-9-7-5-6-8-10-13(12)21-15(20)17-4/h8,10,12-13H,5-7,9,11H2,1-4H3,(H,17,20)(H,18,19)/b10-8- |
| InChIKey | PJYKTMHVPRRZBO-NTMALXAHSA-N |
| XLogP | 2.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|