C11H19NO2 — CID 167046429
2-[(2Z)-cyclooct-2-en-1-yl]oxy-N-methylacetamide (PubChem CID 167046429) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-[(2Z)-cyclooct-2-en-1-yl]oxy-N-methylacetamide.
| Compound Name | 2-[(2Z)-cyclooct-2-en-1-yl]oxy-N-methylacetamide |
|---|---|
| PubChem CID | 167046429 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-[(2Z)-cyclooct-2-en-1-yl]oxy-N-methylacetamide |
| SMILES | CNC(=O)COC1/C=C\CCCCC1 |
| InChI | InChI=1S/C11H19NO2/c1-12-11(13)9-14-10-7-5-3-2-4-6-8-10/h5,7,10H,2-4,6,8-9H2,1H3,(H,12,13)/b7-5- |
| InChIKey | XSNOFQOETVMGHC-ALCCZGGFSA-N |
| XLogP | 1.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|