C15H27NO3 — CID 122495968
[(2E)-6-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] N-ethylcarbamate (PubChem CID 122495968) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is [(2E)-6-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] N-ethylcarbamate.
| Compound Name | [(2E)-6-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 122495968 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | [(2E)-6-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC1/C=C\CCC(OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H27NO3/c1-5-16-14(17)18-12-8-6-7-9-13(11-10-12)19-15(2,3)4/h6,8,12-13H,5,7,9-11H2,1-4H3,(H,16,17)/b8-6- |
| InChIKey | CESWGZDOCBGSFC-VURMDHGXSA-N |
| XLogP | 3.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|